ChemNet > CAS > 120-53-6 6-ethoxy-2-mercaptobenzothiazole
120-53-6 6-ethoxy-2-mercaptobenzothiazole
Ürün Adı |
6-ethoxy-2-mercaptobenzothiazole |
Eş anlamlı |
6-Ethoxybenzothiazolethiol; 6-ethoxy-1,3-benzothiazole-2(3H)-thione; 6-Ethoxy-Benzothiazole-2-Thiol |
Moleküler Formülü |
C9H9NOS2 |
Molekül Ağırlığı |
211.3039 |
InChI |
InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
CAS kayıt numarası |
120-53-6 |
EINECS |
204-405-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.37g/cm3 |
Ergime noktası |
198-200℃ |
Kaynama noktası |
358.5°C at 760 mmHg |
Kırılma indisi |
1.698 |
Alevlenme noktası |
170.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37:Irritating to eyes and respiratory system.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|