ChemNet > CAS > 3096-52-4 2-nitro-9-fluorenone
3096-52-4 2-nitro-9-fluorenone
Ürün Adı |
2-nitro-9-fluorenone |
Eş anlamlı |
2-Nitro-9-fluorenone; 4-07-00-01636 (Beilstein Handbook Reference); BRN 2052959; CCRIS 2540; NSC 12365; 9H-Fluoren-9-one, 2-nitro-; 2-nitro-9H-fluoren-9-one |
Moleküler Formülü |
C13H7NO3 |
Molekül Ağırlığı |
225.1996 |
InChI |
InChI=1/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
CAS kayıt numarası |
3096-52-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.437g/cm3 |
Ergime noktası |
222-223℃ |
Kaynama noktası |
419°C at 760 mmHg |
Kırılma indisi |
1.698 |
Alevlenme noktası |
215.1°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|