ChemNet > CAS > 3102-87-2 2,3,5,6-Tetramethyl-p-phenylenediamine
3102-87-2 2,3,5,6-Tetramethyl-p-phenylenediamine
Ürün Adı |
2,3,5,6-Tetramethyl-p-phenylenediamine |
Eş anlamlı |
3,6-Diaminodurene; 2,3,5,6-tetramethylbenzene-1,4-diamine; 2,3,5,6-tetramethyl-1,4-phenylenediamine |
Moleküler Formülü |
C10H16N2 |
Molekül Ağırlığı |
164.2474 |
InChI |
InChI=1/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
CAS kayıt numarası |
3102-87-2 |
EINECS |
221-457-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.032g/cm3 |
Ergime noktası |
150-153℃ |
Kaynama noktası |
310.6°C at 760 mmHg |
Kırılma indisi |
1.594 |
Alevlenme noktası |
167.8°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|