Details for 2-Mercaptobenzoic Acid

2-Mercaptobenzoic Acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
147-93-3 |
| EC NO: |
205-704-3 |
| Molecular Formula: |
C7H4O2S |
| Molecular Weight: |
152.1716 |
| Specification: |
|
| InChI: |
InChI=1/C7H6O2S/c8-7(9)5-3-1-2-4-6(5)10/h1-4,8-9H/p-2 |
| Synonyms: |
2-Mercaptobenzoic acid;Thiosalicylic acid;o-Carboxy Thiophenol;2-hydroxybenzenecarbothioic S-acid;(6-thioxocyclohexa-2,4-dien-1-ylidene)methanediolate;o-Mercaptobenzoic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-Mercaptobenzoic Acid from Canada ,just feel free to inquire