Details for D-Phenylalanine Methyl Ester Hydrochloride

D-Phenylalanine Methyl Ester Hydrochloride
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
13033-84-6 |
EC NO: |
219-934-7 |
Molecular Formula: |
C10H14ClNO2 |
Molecular Weight: |
215.6767 |
Specification: |
|
InChI: |
InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-;/m1./s1 |
Synonyms: |
H-D-Phe-OMe.HCl;H-D-Phe-OMe HCl;D-phenylalanine methyl ester hcl;methyl L-phenylalaninate;D-Phenylalanine ethyl ester hydrochloride;(2R)-1-methoxy-1-oxo-3-phenylpropan-2-aminium chloride;H-D-Phe-OMe·HCl; |
Molecular Structure: |
 |
if you are sourcing D-Phenylalanine Methyl Ester Hydrochloride from Canada ,just feel free to inquire