Details for Mebeverine Alcohol

Mebeverine Alcohol
| Category: |
|
|
| CAS NO: |
14367-47-6 |
| EC NO: |
|
| Molecular Formula: |
C16H27NO2 |
| Molecular Weight: |
265.3911 |
| Specification: |
|
| InChI: |
InChI=1/C16H27NO2/c1-4-17(11-5-6-12-18)14(2)13-15-7-9-16(19-3)10-8-15/h7-10,14,18H,4-6,11-13H2,1-3H3 |
| Synonyms: |
Mebeverine alcohol;4-(N-Ethyl-N-(4-methoxy-alpha-methylphenethyl)amino)-1-butanol;BRN 2735398;N-Ethyl-N-(4-hydroxybutyl)-4-methoxy-alpha-methylphenethylamine;Phenethylamine, N-ethyl-N-(4-hydroxybutyl)-4-methoxy-alpha-methyl-;1-Butanol, 4-(N-ethyl-N-(4-methoxy-alpha-methylphenethyl)amino)-;4-{ethyl[1-(4-methoxyphenyl)propan-2-yl]amino}butan-1-ol; |
| Molecular Structure: |
 |
if you are sourcing Mebeverine Alcohol from Canada ,just feel free to inquire