Details for N,N-Dimethylpropionamide
N,N-Dimethylpropionamide
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
758-96-3 |
| EC NO: |
212-064-9 |
| Molecular Formula: |
C5H11NO |
| Molecular Weight: |
101.1469 |
| Specification: |
|
| InChI: |
InChI=1/C5H11NO/c1-4-5(7)6(2)3/h4H2,1-3H3 |
| Synonyms: |
Propanamide, N,N-dimethyl-;4-04-00-00184 (Beilstein Handbook Reference);AI3-36614;BRN 1740719;Dimethylamide of propionic acid;Propionamide, N,N-dimethyl;N,N-dimethylpropanamide; |
| Molecular Structure: |
 |
if you are sourcing N,N-Dimethylpropionamide from China ,just feel free to inquire
CN
China Suppliers > JIANYE > 
Search Product