Details for Methyl dihydrojasmonate

Methyl dihydrojasmonate
Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
24851-98-7 |
EC NO: |
246-495-9 |
Molecular Formula: |
C13H22O3 |
Molecular Weight: |
226.312 |
Specification: |
|
InChI: |
InChI=1/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3 |
Synonyms: |
MDJ;Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester;FEMA No. 3408;Kharismal;Methyl (2-pentyl-3-oxocyclopentyl)acetate;Methyl (3-oxo-2-pentylcyclopentyl)acetate;Methyl 3-oxo-2-pentyl-cyclopentaneacetate;Methyl 3-oxo-2-pentylcyclopentaneacetate;Methyl dihydrojasmonate;Dihydrojasmonic acid methyl ester; |
Molecular Structure: |
 |
if you are sourcing Methyl dihydrojasmonate from China ,just feel free to inquire