Details for Ethyl Acetoacetate

Ethyl Acetoacetate
Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
141-97-9 |
EC NO: |
205-516-1 |
Molecular Formula: |
C6H10O3 |
Molecular Weight: |
130.1344 |
Specification: |
|
InChI: |
InChI=1/C6H10O3/c1-3-5(4(2)7)6(8)9/h5H,3H2,1-2H3,(H,8,9)/p-1 |
Synonyms: |
Acetoacetic ester;Ethyl 3-oxobutanoate;Ethyl acetylacetate;Ethyl beta-ketobutyrate;2-ethyl-3-oxobutanoate;Ethyl 3-Oxobutanate;LABOTEST-BB LT01690211; |
Molecular Structure: |
 |
if you are sourcing Ethyl Acetoacetate from China ,just feel free to inquire