Details for propylene glycol methyl ether acetate

 
propylene glycol methyl ether acetate
 
      
        | Category: | 
        Organic chemicals and Derivatives/Acid, ester and anhydride compounds | 
        
        	 | 
      
      
        | CAS NO: | 
      108-65-6   | 
      
      
        | EC NO: | 
        
        283-152-2 | 
      
      
        | Molecular Formula: | 
        
        C6H12O3 | 
      
					
					  | Molecular Weight: | 
                      132.1578 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C5H10O3.C3H6/c1-5(6)8-4-3-7-2;1-3-2/h3-4H2,1-2H3;3H,1H2,2H3 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      1-methoxy-2-acetoxypropane;1-methoxy-2-propanol acetate;1-methoxy-2-propyl acetate;(2-(1-methoxy)propyl) acetate;2-acetoxy-1-methoxypropane;2-methoxy-1-methylethyl acetate;pgmea;propylene glycol monomethyl ether acetate;propylene glycol 1-methyl ether 2-acetate;propylene glycol 1-monomethyl ether 2-acetate;pma-el;2-(methoxy)propyl acetate;2-(1-methoxy)propyl acetate;methoxy propanol acetate;1-methoxypropan-2-yl acetate;1-methoxypropyl acetate;(1S)-2-methoxy-1-methylethyl acetate;(1R)-2-methoxy-1-methylethyl acetate;(acetato-kappaO)(phenyl)mercury;Methoxy propyl acetate;GLYCOL ETHER PMA; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  propylene glycol methyl ether acetate from  China ,just feel free to inquire