Details for L-glutamic acid 5-cyclohexyl ester
L-glutamic acid 5-cyclohexyl ester
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
112471-82-6 |
| EC NO: |
|
| Molecular Formula: |
C11H19NO4 |
| Molecular Weight: |
229.2729 |
| Specification: |
|
| InChI: |
InChI=1/C11H19NO4/c12-9(11(14)15)6-7-10(13)16-8-4-2-1-3-5-8/h8-9H,1-7,12H2,(H,14,15)/t9-/m0/s1 |
| Synonyms: |
H-Glu(OcHex)-OH;L-GLUTAMIC ACID-5-CYCLOHEXYL ESTER;(2S)-2-amino-5-(cyclohexoxy)-5-oxo-pentanoic acid;L-Glutamic Acid 5-Cyclohexyl Ester; |
| Molecular Structure: |
 |
if you are sourcing L-glutamic acid 5-cyclohexyl ester from China ,just feel free to inquire
CN
China Suppliers > aminoacids > 
Search Product