Details for 4-(Diphenylamino)phenylboronic acid

4-(Diphenylamino)phenylboronic acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
201802-67-7 |
| EC NO: |
|
| Molecular Formula: |
C18H16BNO2 |
| Molecular Weight: |
289.1361 |
| Specification: |
|
| InChI: |
InChI=1/C18H16BNO2/c21-19(22)15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,21-22H |
| Synonyms: |
[4-(Diphenylamino)phenyl]boronic acid;boronic acid, B-[4-(diphenylamino)phenyl]-;Triphenylamine-4-Boronic Acid;4-Diphenylamino-phenylboronic acid;4-(Diphenyamino) phenylboronic acid;[4-(N-phenylanilino)phenyl]boronic acid; |
| Molecular Structure: |
 |
if you are sourcing 4-(Diphenylamino)phenylboronic acid from China ,just feel free to inquire