Details for 4-(Methoxycarbonyl)phenylboronic acid

4-(Methoxycarbonyl)phenylboronic acid
Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
99768-12-4 |
EC NO: |
|
Molecular Formula: |
C8H9BO4 |
Molecular Weight: |
179.9657 |
Specification: |
|
InChI: |
InChI=1/C8H9BO4/c1-13-8(10)6-2-4-7(5-3-6)9(11)12/h2-5,11-12H,1H3 |
Synonyms: |
4-(Methoxycarbonyl)phenylboronic acid;4-Borono-benzoic acid 1-methyl ester;4-(Methoxycarbonyl)Benzeneboronic Acid;Methyl 4-boronobenzoate;P-(METHOXYCARBONYL)PHENYLBORONIC ACID;4-(Carbomethoxy)-phenylboronic acid;4-(Methoxycarbonyl)-Phenylboronic Acid; |
Molecular Structure: |
 |
if you are sourcing 4-(Methoxycarbonyl)phenylboronic acid from China ,just feel free to inquire