Details for Sodium Lactate

Sodium Lactate
Category: |
Food and Feed additives |
|
CAS NO: |
312-85-6 |
EC NO: |
206-231-5;200-772-0 |
Molecular Formula: |
C3H5O3Na |
Molecular Weight: |
112.0606 |
Specification: |
|
InChI: |
InChI=1/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1 |
Synonyms: |
dl-lactic acid sodium salt solution;dl-lactic acid sodium;Sodium DL-lactate solution;sodium 2-hydroxypropanoate;propanoic acid, 2-hydroxy-, sodium salt (1:1);Sodium lactate; |
Molecular Structure: |
 |
if you are sourcing Sodium Lactate from China ,just feel free to inquire