Details for 2-thiopheneacetic acid

 
2-thiopheneacetic acid
 
      
        | Category: | 
        Food and Feed additives | 
        
        	 | 
      
      
        | CAS NO: | 
      1918-77-0   | 
      
      
        | EC NO: | 
        
        217-639-8 | 
      
      
        | Molecular Formula: | 
        
        C6H5O2S | 
      
					
					  | Molecular Weight: | 
                      141.1682 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C6H6O2S/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2,(H,7,8)/p-1 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      2-Thenylacetic acid;Thiophene-2-acetic  acid, (2-Thienylacetic  acid);2-Thienylacetic acid;thiophen-2-acetic acid;Thiophene-2-acetic acid;Thien-2-ylacetate;thiophen-2-ylacetic acid;thiophen-2-ylacetate;RARECHEM AL BO 0215;TIMTEC-BB SBB004145;2-Thiophene Acetic Acid; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  2-thiopheneacetic acid from  China ,just feel free to inquire