Details for Solvent Yellow 16

Solvent Yellow 16
| Category: |
Dyestuffs and Pigments/Solvent Dyes |
|
| CAS NO: |
4314-14-1 |
| EC NO: |
224-330-1 |
| Molecular Formula: |
C16H14N4O |
| Molecular Weight: |
278.3086 |
| Specification: |
|
| InChI: |
InChI=1/C16H14N4O/c1-12-15(18-17-13-8-4-2-5-9-13)16(21)20(19-12)14-10-6-3-7-11-14/h2-11,15H,1H3 |
| Synonyms: |
C.I. 12700;CI 12700;Solvent Yellow 16;Yellow GC;5-methyl-2-phenyl-4-[(E)-phenyldiazenyl]-2,4-dihydro-3H-pyrazol-3-one;5-methyl-2-phenyl-4-phenylazo-4H-pyrazol-3-one;Solvent Yellow 16; |
| Molecular Structure: |
 |
if you are sourcing Solvent Yellow 16 from China ,just feel free to inquire