N-Aminoethyl-γ-Aminopropyltrimethoxysilane (KH-792) Suppliers, N-Aminoethyl-γ-Aminopropyltrimethoxysilane (KH-792) Manufacturers.
ZQ-792
( Silane A-1120,Z-6020,KBM-603)
1.Chemical Name: N-(β-aminoethyl)-γ-aminopropyl]trimethoxysilane
2.Molecular Formula: NH2(CH2)2NH(CH2)3Si(OCH3)3
3.Property and Index:
1. Appearance: colorless transparent liquid
2. Assay(%): ≥97.0
3. Density(25oCg/cm3 ):1.015~1.025
4. Refractive index ( nD25 ) :1.441~1.445
5. Boiling point (oC):259
It is colorless transparent liquid, can be dissolved in ethanol, ether, acetone and water etc.; can be hydrolyzed when absorbing moisture; can be slightly condensed when heated at 130 oC up; molecular weight is 222.36
4.Uses :
1. It is an excellent glass fiber treating compound.
2. It is suitable for polyester resin,epoxy resin,phenolic resin,melamine etc.
3. It can be used as finishing agent for textiles.
4. As an inorganic filler widely used in fiberglass,glass wool,carbon white etc.
5. It is especially suitable for vinyl coating,epoxy coating and polyurethane coating etc.
5.Packing&Storage
1. packing: 5kg×4,10kg×2 plastic drum /carton, 195kg spray coating iron drum
2. Storage :Must be sealed
Company: |
Zibo Linzi Qiquan Industrial Trade Co., Ltd |
E-mail: |
chem@netsun.com |
Address: |
Fine chemical park of Qilu Chemical zone, Linzi district, Linzi city, Shandong province, China |
Zip Code: |
255400 |