Details for 2,5-DICHLORO-4-NITRO-ANILINE

2,5-DICHLORO-4-NITRO-ANILINE
| Category: |
Intermediates/Dyestuff intermediates |
|
| CAS NO: |
6627-34-5 |
| EC NO: |
229-591-5 |
| Molecular Formula: |
C6H4Cl2N2O2 |
| Molecular Weight: |
207.0142 |
| Specification: |
|
| InChI: |
InChI=1/C6H4Cl2N2O2/c7-3-2-6(10(11)12)4(8)1-5(3)9/h1-2H,9H2 |
| Synonyms: |
Benzenamine, 2,5-dichloro-4-nitro-;2,5-Dichloro-4-nitrobenzenamine;2-12-00-00400 (Beilstein Handbook Reference);Aniline, 2,5-dichloro-4-nitro-;BRN 2211952;NSC 60645 |
| Molecular Structure: |
 |
if you are sourcing 2,5-DICHLORO-4-NITRO-ANILINE from China ,just feel free to inquire