Details for Disperse Red S-ER

Disperse Red S-ER
| Category: |
Dyestuffs and Pigments/Disperse Dyes |
|
| CAS NO: |
12223-35-7 |
| EC NO: |
255-127-6 |
| Molecular Formula: |
C17H16ClN5O2 |
| Molecular Weight: |
357.7942 |
| Specification: |
|
| InChI: |
InChI=1/C17H16ClN5O2/c1-2-22(11-3-10-19)14-6-4-13(5-7-14)20-21-17-9-8-15(23(24)25)12-16(17)18/h4-9,12H,2-3,11H2,1H3 |
| Synonyms: |
Disperse Red 50;3-[{4-[(E)-(2-chloro-4-nitrophenyl)diazenyl]phenyl}(ethyl)amino]propanenitrile;3-[[4-(2-chloro-4-nitro-phenyl)azophenyl]-ethyl-amino]propanenitrile; |
| Molecular Structure: |
 |
if you are sourcing Disperse Red S-ER from China ,just feel free to inquire