Details for Ethyl butyrylacetate

Ethyl butyrylacetate
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
3249-68-1 |
EC NO: |
221-835-9 |
Molecular Formula: |
C8H14O3 |
Molecular Weight: |
158.195 |
Specification: |
|
InChI: |
InChI=1/C8H14O3/c1-3-5-7(9)6-8(10)11-4-2/h3-6H2,1-2H3 |
Synonyms: |
Ethyl 3-oxohexanoate;3-Oxohexanoic acid ethyl ester;Butyrylacetic acid ethyl ester~Ethyl 3-oxohexanoate~3-Oxohexanoic acid ethyl ester; |
Molecular Structure: |
 |
if you are sourcing Ethyl butyrylacetate from China ,just feel free to inquire