Details for 1,4-Cyclohexanedione

1,4-Cyclohexanedione
| Category: |
Intermediates |
|
| CAS NO: |
637-88-7 |
| EC NO: |
211-306-0 |
| Molecular Formula: |
C6H8O2 |
| Molecular Weight: |
112.1265 |
| Specification: |
GC>99.0% |
| InChI: |
InChI=1/C6H8O2/c7-5-1-2-6(8)4-3-5/h1-4H2 |
| Packing: |
20kg/drum or on request |
Product description:
Chemical Name:1,4-Cyclohexanedione CAS No. 637-88-7 Content: GC>99.5% Appearance: white crystal Application: pharmaceutical intermediate Packing: 20kg/drum or on request Productivity: 10Ton/M |
| Uses: |
pharmaceutical intermeidates |
| Synonyms: |
tetrahydro-p-benzoquinone;1,4-Cyclohexandion;1,4-Cyclohexane Dione;
;cyclohexane-1,4-dione; |
| Molecular Structure: |
 |
if you are sourcing 1,4-Cyclohexanedione from China ,just feel free to inquire