Details for 1-PHENYL-1-PROPANONE

1-PHENYL-1-PROPANONE
| Category: |
Intermediates |
|
| CAS NO: |
93-55-0 |
| EC NO: |
202-257-6 |
| Molecular Formula: |
C9H10O |
| Molecular Weight: |
134.1751 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| Synonyms: |
1-Phenyl-1-propanone;Ethyl phenyl ketone;1-phenyl-1-propanon;1-phenyl-propan-1-one;1-phenylpropanone;1-phenylpropanone-1;1-Propanone,1-phenyl-;Ketone, ethyl phenyl;ketone,ethylphenyl;lithylphenyllwton;phenylpropone;Propionphenone;USAF ek-1235;usafek-1235;αthylenphenylketon;AKOS BBS-00003274;FEMA 3469; |
| Molecular Structure: |
 |
if you are sourcing 1-PHENYL-1-PROPANONE from United-States ,just feel free to inquire