Details for MAPLE LACTONE

MAPLE LACTONE
| Category: |
Other Chemicals/Others |
|
| CAS NO: |
80-71-7 |
| EC NO: |
212-154-8;201-303-2 |
| Molecular Formula: |
C6H8O2 |
| Molecular Weight: |
112.1265 |
| Specification: |
|
| InChI: |
InChI=1/C6H8O2/c1-4-2-3-5(7)6(4)8/h4H,2-3H2,1H3/t4-/m1/s1 |
| Synonyms: |
2-Hydroxy-3-methyl-2-cyclopenten-1-one;3-Methylcyclopentane-1,2-dione;(3S)-3-methylcyclopentane-1,2-dione;(3R)-3-methylcyclopentane-1,2-dione;Maple Lactone;2-hydroxy-3-methylcyclopent-2-enone;Methylcyclopentenolone;Methyl cyclopentenolone;Methyl cyclopentenlone; |
| Molecular Structure: |
 |
if you are sourcing MAPLE LACTONE from United-States ,just feel free to inquire