Details for 7-Acetoxy 4-Methyl coumarin

7-Acetoxy 4-Methyl coumarin
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
2747-05-9 |
| EC NO: |
220-386-6 |
| Molecular Formula: |
C12H12O4 |
| Molecular Weight: |
220.2213 |
| Specification: |
|
| InChI: |
InChI=1/C12H12O4/c1-7-5-12(15-8(2)13)16-11-6-9(14)3-4-10(7)11/h3-6,12,14H,1-2H3 |
| Synonyms: |
4-Methylumbelliferyl acetate;4-Methylumbeliferyl acetate;2-acetoxymethyl-5-(1,3-dioxolan-2-yl)furan;4-methyl-2-oxo-2H-chromen-7-yl acetate;7-hydroxy-4-methyl-2H-chromen-2-yl acetate; |
| Molecular Structure: |
 |
if you are sourcing 7-Acetoxy 4-Methyl coumarin from India ,just feel free to inquire