Details for ALLYL THIOPROPIONATE

ALLYL THIOPROPIONATE
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
41820-22-8 |
| EC NO: |
|
| Molecular Formula: |
C6H10OS |
| Molecular Weight: |
130.208 |
| Specification: |
|
| InChI: |
InChI=1/C6H10OS/c1-3-5-8-6(7)4-2/h3H,1,4-5H2,2H3 |
| Synonyms: |
Propanethioic acid, S-2-propenyl ester;Allyl thiopropionate;FEMA No. 3329;S-2-Propenyl propanethioate;S-Allyl thiopropionate;S-prop-2-en-1-yl propanethioate; |
| Molecular Structure: |
 |
if you are sourcing ALLYL THIOPROPIONATE from United-States ,just feel free to inquire