ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| název výrobku |
methyl 4-cyanobenzoate |
| Synonyma |
4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| Molekulární vzorec |
C9H7NO2 |
| Molekulová hmotnost |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| Registrační číslo CAS |
1129-35-7 |
| EINECS |
214-443-4 |
| Molekulární struktura |
|
| Hustota |
1.18g/cm3 |
| Bod tání |
62℃ |
| Bod varu |
274.9°C at 760 mmHg |
| Index lomu |
1.535 |
| Bod vzplanutí |
131.2°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
