ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| název výrobku |
2-acetyl-3-methylthiophene |
| Synonyma |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| Molekulární vzorec |
C7H8OS |
| Molekulová hmotnost |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| Registrační číslo CAS |
13679-72-6 |
| EINECS |
237-179-1 |
| Molekulární struktura |
|
| Hustota |
1.106g/cm3 |
| Bod varu |
214.9°C at 760 mmHg |
| Index lomu |
1.535 |
| Bod vzplanutí |
92.3°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
