ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
název výrobku |
2-acetyl-3-methylthiophene |
Synonyma |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
Molekulární vzorec |
C7H8OS |
Molekulová hmotnost |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
Registrační číslo CAS |
13679-72-6 |
EINECS |
237-179-1 |
Molekulární struktura |
|
Hustota |
1.106g/cm3 |
Bod varu |
214.9°C at 760 mmHg |
Index lomu |
1.535 |
Bod vzplanutí |
92.3°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|