ChemNet > CAS > 153195-01-8 (2-amino-5-ethyl-3-thienyl) (4-methoxyfenyl)methanon
153195-01-8 (2-amino-5-ethyl-3-thienyl) (4-methoxyfenyl)methanon
| název výrobku |
(2-amino-5-ethyl-3-thienyl) (4-methoxyfenyl)methanon |
| Synonyma |
(2-amino-5-ethylthiofen-3-yl) (4-methoxyfenyl)methanon |
| Anglický název |
(2-amino-5-ethyl-3-thienyl)(4-methoxyphenyl)methanone;(2-amino-5-ethylthiophen-3-yl)(4-methoxyphenyl)methanone |
| Molekulární vzorec |
C14H15NO2S |
| Molekulová hmotnost |
261.3394 |
| InChI |
InChI=1/C14H15NO2S/c1-3-11-8-12(14(15)18-11)13(16)9-4-6-10(17-2)7-5-9/h4-8H,3,15H2,1-2H3 |
| Registrační číslo CAS |
153195-01-8 |
| Molekulární struktura |
|
| Hustota |
1.209g/cm3 |
| Bod tání |
100℃ |
| Bod varu |
458.9°C at 760 mmHg |
| Index lomu |
1.609 |
| Bod vzplanutí |
231.4°C |
| Tlak par |
1.32E-08mmHg at 25°C |
| Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|