ChemNet > CAS > 1577-22-6 5-Hexenoic acid
1577-22-6 5-Hexenoic acid
název výrobku |
5-Hexenoic acid |
Synonyma |
hex-5-enoic acid |
Molekulární vzorec |
C6H10O2 |
Molekulová hmotnost |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) |
Registrační číslo CAS |
1577-22-6 |
Molekulární struktura |
|
Hustota |
0.973g/cm3 |
Bod varu |
202.6°C at 760 mmHg |
Index lomu |
1.443 |
Bod vzplanutí |
100.1°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R34:Causes burns.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|