ChemNet > CAS > 3693-53-6 Diethyl methylenedicarbamate
3693-53-6 Diethyl methylenedicarbamate
| název výrobku |
Diethyl methylenedicarbamate |
| Synonyma |
Methylene diurethane; diethyl methanediylbiscarbamate |
| Molekulární vzorec |
C7H14N2O4 |
| Molekulová hmotnost |
190.1971 |
| InChI |
InChI=1/C7H14N2O4/c1-3-12-6(10)8-5-9-7(11)13-4-2/h3-5H2,1-2H3,(H,8,10)(H,9,11) |
| Registrační číslo CAS |
3693-53-6 |
| EINECS |
223-011-4 |
| Molekulární struktura |
|
| Hustota |
1.127g/cm3 |
| Bod varu |
326.2°C at 760 mmHg |
| Index lomu |
1.448 |
| Bod vzplanutí |
151.1°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R40:Possible risks of irreversible effects.;
|
| Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
