10352-88-2 trans-2-Heptensäure
Produkt-Name |
trans-2-Heptensäure |
Synonyme |
Heptensäuretech; Hept-2-enoat; (2E)-Hept-2-ensäure |
Englischer Name |
trans-2-Heptenoic acid; Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
Molekulare Formel |
C7H12O2 |
Molecular Weight |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
CAS Registry Number |
10352-88-2 |
EINECS |
233-769-8 |
Molecular Structure |
|
Dichte |
0.968g/cm3 |
Siedepunkt |
226.6°C at 760 mmHg |
Brechungsindex |
1.457 |
Flammpunkt |
133.4°C |
Dampfdruck |
0.0295mmHg at 25°C |
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|