ChemNet > CAS > 1072-12-4 Glyoxal-Dithiosemicarbazon
1072-12-4 Glyoxal-Dithiosemicarbazon
| Produkt-Name |
Glyoxal-Dithiosemicarbazon |
| Synonyme |
; Glyoxalbis(thiosemicarbazon); ethanediales Dithiosemicarbazon; (1Z,2Z)-ethanediales Dithiosemicarbazon |
| Englischer Name |
Glyoxal dithiosemicarbazone; Glyoxal bis(thiosemicarbazone); ethanedial dithiosemicarbazone; (1Z,2Z)-ethanedial dithiosemicarbazone |
| Molekulare Formel |
C4H8N6S2 |
| Molecular Weight |
204.2765 |
| InChI |
InChI=1/C4H8N6S2/c5-3(11)9-7-1-2-8-10-4(6)12/h1-2H,(H3,5,9,11)(H3,6,10,12)/b7-1-,8-2- |
| CAS Registry Number |
1072-12-4 |
| Molecular Structure |
|
| Dichte |
1.61g/cm3 |
| Siedepunkt |
384.6°C at 760 mmHg |
| Brechungsindex |
1.75 |
| Flammpunkt |
186.4°C |
| Dampfdruck |
4.03E-06mmHg at 25°C |
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|