ChemNet > CAS > 116493-07-3 4-Cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophen-2-carbonsäure
116493-07-3 4-Cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophen-2-carbonsäure
| Produkt-Name |
4-Cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophen-2-carbonsäure |
| Synonyme |
4-Cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophen-2-carbonsäure |
| Englischer Name |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid;4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| Molekulare Formel |
C14H11NO3S2 |
| Molecular Weight |
305.372 |
| InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| CAS Registry Number |
116493-07-3 |
| Molecular Structure |
|
| Dichte |
1.43g/cm3 |
| Schmelzpunkt |
209℃ |
| Siedepunkt |
464.9°C at 760 mmHg |
| Brechungsindex |
1.67 |
| Flammpunkt |
234.9°C |
| Dampfdruck |
1.93E-09mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|