ChemNet > CAS > 132-60-5 2-Phenyl-4-quinolinecarboxylic acid
132-60-5 2-Phenyl-4-quinolinecarboxylic acid
| Produkt-Name |
2-Phenyl-4-quinolinecarboxylic acid |
| Synonyme |
2-Phenylcinchoninic acid; Cinchophen~2-Phenylcinchoninic acid; Cinchophen; 2-phenylquinoline-4-carboxylic acid; 2-phenylquinoline-4-carboxylate |
| Molekulare Formel |
C16H10NO2 |
| Molecular Weight |
248.2566 |
| InChI |
InChI=1/C16H11NO2/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H,(H,18,19)/p-1 |
| CAS Registry Number |
132-60-5 |
| EINECS |
205-067-1 |
| Molecular Structure |
|
| Schmelzpunkt |
213-216℃ |
| Siedepunkt |
456.9°C at 760 mmHg |
| Flammpunkt |
230.1°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
