ChemNet > CAS > 13506-76-8 2-Methyl-6-nitrobenzoic acid
13506-76-8 2-Methyl-6-nitrobenzoic acid
Produkt-Name |
2-Methyl-6-nitrobenzoic acid |
Synonyme |
6-Nitro-o-toluic acid; 2-methyl-6-nitrobenzoate |
Molekulare Formel |
C8H6NO4 |
Molecular Weight |
180.1381 |
InChI |
InChI=1/C8H7NO4/c1-5-3-2-4-6(9(12)13)7(5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
CAS Registry Number |
13506-76-8 |
EINECS |
236-833-3 |
Molecular Structure |
|
Schmelzpunkt |
154-157℃ |
Siedepunkt |
352.8°C at 760 mmHg |
Flammpunkt |
159.7°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|