ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
Produkt-Name |
1-Piperidinethiocarboxamide |
Synonyme |
piperidine-1-carbothioamide |
Molekulare Formel |
C6H12N2S |
Molecular Weight |
144.2379 |
InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
CAS Registry Number |
14294-09-8 |
Molecular Structure |
|
Dichte |
1.165g/cm3 |
Siedepunkt |
237.3°C at 760 mmHg |
Brechungsindex |
1.593 |
Flammpunkt |
97.3°C |
Gefahrensymbole |
|
Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|