ChemNet > CAS > 149552-52-3 (S)-1-(4-Bromophenyl)ethyl isocyanate
149552-52-3 (S)-1-(4-Bromophenyl)ethyl isocyanate
| Produkt-Name |
(S)-1-(4-Bromophenyl)ethyl isocyanate |
| Synonyme |
1-bromo-4-[(1S)-1-isocyanatoethyl]benzene; (S)-(-)-1-(4-Bromophenyl)Ethyl Isocyanate |
| Molekulare Formel |
C9H8BrNO |
| Molecular Weight |
226.0699 |
| InChI |
InChI=1/C9H8BrNO/c1-7(11-6-12)8-2-4-9(10)5-3-8/h2-5,7H,1H3/t7-/m0/s1 |
| CAS Registry Number |
149552-52-3 |
| Molecular Structure |
|
| Dichte |
1.39g/cm3 |
| Siedepunkt |
276.3°C at 760 mmHg |
| Brechungsindex |
1.562 |
| Flammpunkt |
120.9°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
