ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
| Produkt-Name |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
| Synonyme |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
| Molekulare Formel |
C6H2BF5O2 |
| Molecular Weight |
211.8819 |
| InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
| CAS Registry Number |
1582-24-7 |
| Molecular Structure |
|
| Dichte |
1.61g/cm3 |
| Siedepunkt |
244°C at 760 mmHg |
| Brechungsindex |
1.429 |
| Flammpunkt |
101.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
