ChemNet > CAS > 1635-31-0 3-Aminocoumarin
1635-31-0 3-Aminocoumarin
| Produkt-Name |
3-Aminocoumarin |
| Synonyme |
3-Coumarinamine; 3-amino-2H-chromen-2-one |
| Molekulare Formel |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
| CAS Registry Number |
1635-31-0 |
| EINECS |
216-659-4 |
| Molecular Structure |
|
| Dichte |
1.313g/cm3 |
| Siedepunkt |
355.2°C at 760 mmHg |
| Brechungsindex |
1.624 |
| Flammpunkt |
199.3°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
