ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
| Produkt-Name |
diethyl (3-chloropropyl)malonate |
| Synonyme |
(3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
| Molekulare Formel |
C10H17ClO4 |
| Molecular Weight |
236.6926 |
| InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
| CAS Registry Number |
18719-43-2 |
| Molecular Structure |
|
| Dichte |
1.114g/cm3 |
| Siedepunkt |
290.2°C at 760 mmHg |
| Brechungsindex |
1.447 |
| Flammpunkt |
111.9°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
