ChemNet > CAS > 2094-73-7 Ethyl adamantane-1-carboxylate
2094-73-7 Ethyl adamantane-1-carboxylate
| Produkt-Name |
Ethyl adamantane-1-carboxylate |
| Synonyme |
Adamantane-1-carboxylic acid ethyl ester; ethyl tricyclo[3.3.1.1~3,7~]decane-1-carboxylate |
| Molekulare Formel |
C13H20O2 |
| Molecular Weight |
208.2967 |
| InChI |
InChI=1/C13H20O2/c1-2-15-12(14)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,2-8H2,1H3 |
| CAS Registry Number |
2094-73-7 |
| EINECS |
218-253-2 |
| Molecular Structure |
|
| Dichte |
1.106g/cm3 |
| Siedepunkt |
261.8°C at 760 mmHg |
| Brechungsindex |
1.524 |
| Flammpunkt |
109.9°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
