ChemNet > CAS > 2150-43-8 Methyl 3,4-dihydroxybenzoate
2150-43-8 Methyl 3,4-dihydroxybenzoate
| Produkt-Name |
Methyl 3,4-dihydroxybenzoate |
| Synonyme |
3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
| Molekulare Formel |
C8H8O4 |
| Molecular Weight |
168.1467 |
| InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| CAS Registry Number |
2150-43-8 |
| Molecular Structure |
|
| Dichte |
1.354g/cm3 |
| Siedepunkt |
351.5°C at 760 mmHg |
| Brechungsindex |
1.587 |
| Flammpunkt |
148.5°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
