ChemNet > CAS > 2254-94-6 N-Methylbenzothiazol-2-thion
2254-94-6 N-Methylbenzothiazol-2-thion
| Produkt-Name |
N-Methylbenzothiazol-2-thion |
| Synonyme |
3-Methylbenzothiazol-2-thion; 3-Methyl-1,3-benzothiazol-2(3H)-thion |
| Englischer Name |
N-Methylbenzothiazole-2-thione; 3-Methylbenzothiazole-2-thione; 3-methyl-1,3-benzothiazole-2(3H)-thione |
| Molekulare Formel |
C8H7NS2 |
| Molecular Weight |
181.2779 |
| InChI |
InChI=1/C8H7NS2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h2-5H,1H3 |
| CAS Registry Number |
2254-94-6 |
| EINECS |
218-852-9 |
| Molecular Structure |
|
| Dichte |
1.39g/cm3 |
| Schmelzpunkt |
88-91℃ |
| Siedepunkt |
300.6°C at 760 mmHg |
| Brechungsindex |
1.753 |
| Flammpunkt |
135.6°C |
| Dampfdruck |
0.00111mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|