ChemNet > CAS > 2905-69-3 Methyl 2,5-dichlorobenzoate
2905-69-3 Methyl 2,5-dichlorobenzoate
| Produkt-Name |
Methyl 2,5-dichlorobenzoate |
| Synonyme |
2,5-Dichlorobenzoic acid methyl ester |
| Molekulare Formel |
C8H6Cl2O2 |
| Molecular Weight |
205.038 |
| InChI |
InChI=1/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
| CAS Registry Number |
2905-69-3 |
| EINECS |
220-815-7 |
| Molecular Structure |
|
| Dichte |
1.355g/cm3 |
| Siedepunkt |
265.2°C at 760 mmHg |
| Brechungsindex |
1.545 |
| Flammpunkt |
113.2°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
