ChemNet > CAS > 29840-73-1 2-Bromopyridine-4-carboxamide
29840-73-1 2-Bromopyridine-4-carboxamide
| Produkt-Name |
2-Bromopyridine-4-carboxamide |
| Synonyme |
2-Bromoisonicotinamide |
| Molekulare Formel |
C6H5BrN2O |
| Molecular Weight |
201.0207 |
| InChI |
InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| CAS Registry Number |
29840-73-1 |
| Molecular Structure |
|
| Dichte |
1.71g/cm3 |
| Siedepunkt |
338.1°C at 760 mmHg |
| Brechungsindex |
1.613 |
| Flammpunkt |
158.3°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
