ChemNet > CAS > 30233-64-8 Docosansäure, Monoester mit Glycerin
30233-64-8 Docosansäure, Monoester mit Glycerin
| Produkt-Name |
Docosansäure, Monoester mit Glycerin |
| Synonyme |
2,3-Dihydroxypropyldocosanoat; Docosansäure, 2,3-Dihydroxypropylester; Docosansäure, Monoester mit 1,2,3-Propantriol; Glycerylmonobehenat; Behen-Monoglycerid; Glycerinmonobehenat; Docosansäure, Monoester mit Glycerin; 1,3-Dihydroxypropan-2-yldocosanoat |
| Englischer Name |
docosanoic acid, monoester with glycerol; 2,3-Dihydroxypropyl docosanoate; Docosanoic acid, 2,3-dihydroxypropyl ester; Docosanoic acid, monoester with 1,2,3-propanetriol; Glyceryl monobehenate; Behenic monoglyceride; Glycerine monobehenate; Docosanoic acid, monoester with glycerol; 1,3-dihydroxypropan-2-yl docosanoate; Glyceryl Behenate |
| Molekulare Formel |
C25H50O4 |
| Molecular Weight |
414.6621 |
| InChI |
InChI=1/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-24(22-26)23-27/h24,26-27H,2-23H2,1H3 |
| CAS Registry Number |
30233-64-8 |
| EINECS |
250-097-0 |
| Molecular Structure |
|
| Dichte |
0.942g/cm3 |
| Siedepunkt |
533.8°C at 760 mmHg |
| Brechungsindex |
1.469 |
| Flammpunkt |
164.6°C |
| Dampfdruck |
1.27E-13mmHg at 25°C |
|