ChemNet > CAS > 30657-38-6 L-Lysin, Verbindung mit 5-Oxo-L-Prolin (1:1)
30657-38-6 L-Lysin, Verbindung mit 5-Oxo-L-Prolin (1:1)
| Produkt-Name |
L-Lysin, Verbindung mit 5-Oxo-L-Prolin (1:1) |
| Synonyme |
L-Lysin, komp.u. 5-Oxo-L-Prolin (1:1); Lysin PCA; L-Lysin, Verbindung mit 5-Oxo-L-Prolin (1:1); 5-Oxo-L-Prolin - L-Lysin (1:1) |
| Englischer Name |
L-lysine, compound with 5-oxo-L-proline (1:1);L-Lysine, compd. with 5-oxo-L-proline (1:1); Lysine PCA; L-Lysine, compound with 5-oxo-L-proline (1:1); 5-oxo-L-proline - L-lysine (1:1) |
| Molekulare Formel |
C11H21N3O5 |
| Molecular Weight |
275.3015 |
| InChI |
InChI=1/C6H14N2O2.C5H7NO3/c7-4-2-1-3-5(8)6(9)10;7-4-2-1-3(6-4)5(8)9/h5H,1-4,7-8H2,(H,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t5-;3-/m00/s1 |
| CAS Registry Number |
30657-38-6 |
| EINECS |
250-275-8 |
| Molecular Structure |
|
| Siedepunkt |
624.4°C at 760 mmHg |
| Flammpunkt |
331.4°C |
| Dampfdruck |
3.4E-17mmHg at 25°C |
|