ChemNet > CAS > 3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
Produkt-Name |
ethyl 5-methylisoxazole-3-carboxylate |
Synonyme |
5-methylisoxazole-3-carboxylate ethyl; ethyl 5-methyl-1,2-oxazole-3-carboxylate |
Molekulare Formel |
C7H9NO3 |
Molecular Weight |
155.1513 |
InChI |
InChI=1/C7H9NO3/c1-3-10-7(9)6-4-5(2)11-8-6/h4H,3H2,1-2H3 |
CAS Registry Number |
3209-72-1 |
EINECS |
221-720-3 |
Molecular Structure |
|
Dichte |
1.139g/cm3 |
Schmelzpunkt |
25℃ |
Siedepunkt |
246.2°C at 760 mmHg |
Brechungsindex |
1.468 |
Flammpunkt |
102.7°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|