ChemNet > CAS > 3319-99-1 2-(2-thienyl)pyridine
3319-99-1 2-(2-thienyl)pyridine
| Produkt-Name |
2-(2-thienyl)pyridine |
| Synonyme |
2-(2-Pyridyl)thiophene; 2-(thiophen-2-yl)pyridine |
| Molekulare Formel |
C9H7NS |
| Molecular Weight |
161.2236 |
| InChI |
InChI=1/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
| CAS Registry Number |
3319-99-1 |
| EINECS |
222-022-1 |
| Molecular Structure |
|
| Dichte |
1.173g/cm3 |
| Siedepunkt |
268°C at 760 mmHg |
| Brechungsindex |
1.604 |
| Flammpunkt |
115°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
