ChemNet > CAS > 3414-94-6 3-Phenyl-1,2,4-triazole-5-thiol hydrate
3414-94-6 3-Phenyl-1,2,4-triazole-5-thiol hydrate
| Produkt-Name |
3-Phenyl-1,2,4-triazole-5-thiol hydrate |
| Synonyme |
5-phenyl-1H-1,2,4-triazole-3-thiol; 5-phenyl-4H-1,2,4-triazole-3-thiol |
| Molekulare Formel |
C8H7N3S |
| Molecular Weight |
177.2263 |
| InChI |
InChI=1/C8H7N3S/c12-8-9-7(10-11-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11,12) |
| CAS Registry Number |
3414-94-6 |
| Molecular Structure |
|
| Dichte |
1.39g/cm3 |
| Schmelzpunkt |
253-255℃ |
| Siedepunkt |
267.8°C at 760 mmHg |
| Brechungsindex |
1.731 |
| Flammpunkt |
115.8°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
